CAS 51770-71-9
:2,4-Dimethoxybenzenesulfonamide
Description:
2,4-Dimethoxybenzenesulfonamide, with the CAS number 51770-71-9, is an organic compound characterized by the presence of a sulfonamide functional group attached to a dimethoxy-substituted benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, such as water and alcohols, due to the sulfonamide group. The dimethoxy groups enhance its electron-donating properties, which can influence its reactivity and interactions in various chemical environments. 2,4-Dimethoxybenzenesulfonamide may be utilized in pharmaceutical applications, particularly as a building block in the synthesis of biologically active compounds. Its sulfonamide moiety can impart antibacterial properties, making it relevant in medicinal chemistry. Additionally, the compound's stability under standard laboratory conditions allows for its use in various synthetic pathways. As with many sulfonamides, it is essential to handle this compound with care, considering potential allergic reactions in sensitive individuals. Overall, 2,4-Dimethoxybenzenesulfonamide is a versatile compound with significant implications in both research and application.
Formula:C8H11NO4S
InChI:InChI=1/C8H11NO4S/c1-12-6-3-4-8(14(9,10)11)7(5-6)13-2/h3-5H,1-2H3,(H2,9,10,11)
SMILES:COc1ccc(c(c1)OC)S(=O)(=O)N
Synonyms:- Benzenesulfonamide, 2,4-Dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Dimethoxybenzenesulfonamide, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11NO4SPurity:96%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:217.252,4-Dimethoxybenzenesulfonamide
CAS:Formula:C8H11NO4SPurity:96%Color and Shape:SolidMolecular weight:217.24222,4-Dimethoxybenzenesulfonamide
CAS:2,4-DimethoxybenzenesulfonamidePurity:98%Molecular weight:217.24g/mol2,4-Dimethoxybenzenesulfonamide
CAS:Versatile small molecule scaffold
Formula:C8H11NO4SPurity:Min. 95%Molecular weight:217.25 g/mol




