CAS 51776-71-7

1-bromo-4-(difluoromethyl)benzene

Description:

1-Bromo-4-(difluoromethyl)benzene, with the CAS number 51776-71-7, is an aromatic compound characterized by the presence of a bromine atom and a difluoromethyl group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the difluoromethyl group, which consists of two fluorine atoms bonded to a carbon atom. The presence of the bromine atom imparts certain reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. The difluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the electronegative fluorine atoms and the bromine substituent, which can affect its interactions with other molecules. Overall, 1-bromo-4-(difluoromethyl)benzene is a valuable compound in both industrial applications and research settings.

Formula: C₇H₅BrF₂

InChI: InChI=1/C7H5BrF2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,7H

SMILES: c1cc(ccc1C(F)F)Br

Synonyms:

• Benzene, 1-bromo-4-(difluoromethyl)-

1-Bromo-4-(difluoromethyl)benzene

CAS: 51776-71-7

Formula: C₇H₅BrF₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.0154

Ref: IN-DA0032PS

4-Bromobenzal fluoride

CAS: 51776-71-7

4-Bromobenzal fluoride

Formula: C₇H₅BrF₂

Purity: 95%

Color and Shape: clear liquid

Molecular weight: 207.0154g/mol

Ref: 54-PC49528

1-Bromo-4-(difluoromethyl)benzene

CAS: 51776-71-7

Formula: C₇H₅BrF₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 207.018

Ref: 10-F023880