CAS 51777-15-2

[4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethanone

Description:

[4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethanone, with the CAS number 51777-15-2, is an organic compound characterized by its complex structure, which includes a phenylmethanone moiety and a dimethylaminoethoxy substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the dimethylamino group suggests that it may exhibit basic properties, while the ether functionality can influence its solubility and reactivity. Additionally, the compound may display photochemical properties due to the presence of the carbonyl group, which can absorb UV light. Its molecular structure allows for potential interactions with biological systems, making it of interest for drug development. Overall, the characteristics of this compound, including its solubility, reactivity, and biological activity, would depend on the specific conditions under which it is studied or utilized.

Formula: C₁₇H₁₉NO₂

InChI: InChI=1S/C17H19NO2/c1-18(2)12-13-20-16-10-8-15(9-11-16)17(19)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3

InChI key: InChIKey=YVDXPPVFFOUDJK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCN(C)C)C=C1)C2=CC=CC=C2

Synonyms:

• 4-(Dimethylaminoethoxy)benzophenone
• Benzophenone, 4-(2-dimethylaminoethoxy)-
• Methanone, [4-[2-(Dimethylamino)Ethoxy]Phenyl]Phenyl-
• [2-(4-Benzoylphenoxy)ethyl]dimethylamine
• [4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethanone

4-(Dimethylaminoethoxy)benzophenone

Controlled Product

CAS: 51777-15-2

Applications 4-(Dimethylaminoethoxy)benzophenone is an photo-degradation product Tamoxifen (T006000), a selective estrogen response modifier (SERM), protein kinase C inhibitor and anti-angiogenetic factor.

Formula: C₁₇H₁₉NO₂

Color and Shape: Neat

Molecular weight: 269.34

Ref: TR-D472760

Tamoxifen Impurity 3

CAS: 51777-15-2

Formula: C₁₇H₁₉NO₂

Molecular weight: 269.3

Ref: ST-EA-CP-T40016