CAS 51779-32-9: 1,3-Bis(1,1-dimethylethyl) imidodicarbonate
Description:1,3-Bis(1,1-dimethylethyl)imidodicarbonate, with the CAS number 51779-32-9, is a chemical compound that belongs to the class of imidodicarbonates. It is characterized by its unique structure, which features two tert-butyl groups attached to an imidodicarbonate moiety. This compound is typically used as a reagent in organic synthesis and can serve as a protecting group for amines due to its ability to form stable derivatives. It is known for its relatively low volatility and stability under standard conditions, making it suitable for various chemical reactions. The presence of the bulky tert-butyl groups contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, it may exhibit properties such as solubility in organic solvents and potential applications in polymer chemistry or as an intermediate in the synthesis of more complex organic compounds. Safety precautions should be taken when handling this substance, as with many chemical reagents, due to potential toxicity or reactivity.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-9(2,3)14-7(12)11-8(13)15-10(4,5)6/h1-6H3,(H,11,12,13)
InChI key:InChIKey=XCAQIUOFDMREBA-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NC(=O)OC(C)(C)C
- Synonyms:
- (Boc)2Nh
- 1,3-Bis(1,1-dimethylethyl) imidodicarbonate
- Bis(Boc)amine
- Bis(tert-butoxycarbonyl)amine
- Bis(tert-butoxycarbonyl)ammonia
- Di-Tert-Butyl Imidodicarbonate
- Di-t-butyl iminodicarbonate
- Di-tert-butyl imidodicarboxylate
- Imidodicarbonic acid, 1,3-bis(1,1-dimethylethyl) ester
- Imidodicarbonic acid, C,C'-bis(1,1-dimethylethyl) ester
- See more synonyms
- Imidodicarbonic acid, bis(1,1-dimethylethyl) ester
- Imidodicarboxylic acid, di-tert-butyl ester
- Iminodicarboxylic acid di-tert-butyl ester
- N-Boc-tert-butylcarbamate
- NSC 131088
- tert-Butyl N-(tert-butoxycarbonyl)carbamate
- Di-tert-butyl iminodicarboxylate
