CAS 517920-69-3

5-bromo-3-fluorobenzene-1,2-diamine

Description:

5-Bromo-3-fluorobenzene-1,2-diamine is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with two amino groups (-NH2) at the 1 and 2 positions. This compound features a bromine atom at the 5-position and a fluorine atom at the 3-position of the benzene ring, contributing to its unique reactivity and properties. The presence of the amino groups makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, the halogen substituents can influence the compound's electronic properties, potentially affecting its solubility and interaction with other molecules. 5-Bromo-3-fluorobenzene-1,2-diamine may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 517920-69-3, allows for easy identification and retrieval of information regarding its safety, handling, and applications in research and industry.

Formula: C₆H₆BrFN₂

InChI: InChI=1/C6H6BrFN2/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,9-10H2

SMILES: c1c(cc(c(c1F)N)N)Br

Synonyms:

• 1,2-Diamino-4-bromo-6-fluorobenzene

5-Bromo-3-fluorobenzene-1,2-diamine

CAS: 517920-69-3

Formula: C₆H₆BrFN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.0276

Ref: IN-DA0037QJ

5-Bromo-3-fluorobenzene-1,2-diamine

CAS: 517920-69-3

5-Bromo-3-fluorobenzene-1,2-diamine

Formula: C₆H₆BrFN₂

Purity: 97%

Color and Shape: faint red to faint purple to light brown crystalline solid

Molecular weight: 205.03g/mol

Ref: 54-PC5177

5-Bromo-3-fluorobenzene-1,2-diamine

CAS: 517920-69-3

Formula: C₆H₆BrFN₂

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 205.03

Ref: 10-F210565