CAS 51794-07-1

2-Hydroxy-5-nitrobenzeneacetic acid

Description:

2-Hydroxy-5-nitrobenzeneacetic acid, also known as salicylamide-5-nitro, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a nitro group (-NO2) attached to a benzene ring, along with an acetic acid moiety. This compound typically exhibits properties associated with aromatic acids, including moderate solubility in polar solvents due to the presence of the hydroxyl group, while the nitro group can influence its reactivity and polarity. The presence of the hydroxyl group also suggests potential for hydrogen bonding, which can affect its physical properties such as melting and boiling points. Additionally, the nitro group may impart certain electrophilic characteristics, making the compound reactive in various chemical reactions. 2-Hydroxy-5-nitrobenzeneacetic acid may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications can vary based on its reactivity and biological activity. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₈H₇NO₅

InChI: InChI=1S/C8H7NO5/c10-7-2-1-6(9(13)14)3-5(7)4-8(11)12/h1-3,10H,4H2,(H,11,12)

InChI key: InChIKey=ORXCFNAIXBBSJC-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=CC(N(=O)=O)=CC=C1O

Synonyms:

• (2-Hydroxy-5-nitrophenyl)acetic acid
• Benzeneacetic acid, 2-hydroxy-5-nitro-
• 2-Hydroxy-5-nitrobenzeneacetic acid
• 2-(2-Hydroxy-5-nitrophenyl)acetic acid
• 2-Hydroxy-5-nitro-α-toluic acid

2-hydroxy-5-nitrophenylacetic acid

CAS: 51794-07-1

Formula: C₈H₇NO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.1449

Ref: IN-DA00D8Q7

2-Hydroxy-5-nitrophenylacetic acid

CAS: 51794-07-1

2-Hydroxy-5-nitrophenylacetic acid is a versatile building block that can be used as a reagent, speciality chemical, or research chemical. It has been synthesized and characterized from the nitrobenzene derivative 2-hydroxyacetophenone. The compound has been shown to inhibit the growth of bacteria by binding to bacterial DNA gyrase and topoisomerase IV. This inhibits bacterial growth by preventing DNA replication and transcription. As an intermediate, 2-hydroxy-5-nitrophenylacetic acid is useful in organic synthesis as a reaction component or scaffold.

Formula: C₈H₇NO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 197.14 g/mol

Ref: 3D-FH67645