CAS 518-75-2
:Citrinin
Description:
Citrinin is a mycotoxin produced by various species of fungi, particularly those in the Penicillium and Monascus genera. It is primarily known for its yellowish color and is classified as a polyketide. Citrinin has a molecular formula of C13H14O5 and a molecular weight of approximately 250 g/mol. This compound is soluble in organic solvents like methanol and ethanol but has limited solubility in water. Citrinin is recognized for its nephrotoxic effects, which can lead to kidney damage in humans and animals upon exposure. It has been implicated in various food safety concerns, particularly in fermented products and grains contaminated with the producing fungi. Due to its toxicological profile, citrinin is subject to regulatory scrutiny, and efforts are made to monitor and limit its presence in food products. Additionally, research continues into its biochemical mechanisms and potential health impacts, emphasizing the importance of understanding mycotoxins in food safety and public health.
Formula:C13H14O5
InChI:InChI=1S/C13H14O5/c1-5-7(3)18-4-8-9(5)6(2)11(14)10(12(8)15)13(16)17/h4-5,7,15H,1-3H3,(H,16,17)/t5-,7-/m1/s1
InChI key:InChIKey=CQIUKKVOEOPUDV-IYSWYEEDSA-N
SMILES:CC1=C2C(C(O)=C(C(O)=O)C1=O)=CO[C@H](C)[C@H]2C
Synonyms:- (3R,4S)-4,6-Dihydro-8-hydroxy-3,4,5-trimethyl-6-oxo-3H-2-benzopyran-7-carboxylic acid
- 4,6-Dihydro-8-hydroxy-3,4,5-trimethyl-6-oxo-3H-2-benzopyran-7-carboxylic acid
- 3H-2-Benzopyran-7-carboxylic acid, 4,6-dihydro-8-hydroxy-3,4,5-trimethyl-6-oxo-, (3R-trans)-
- Citrinin
- 3H-2-Benzopyran-7-carboxylic acid, 4,6-dihydro-8-hydroxy-3,4,5-trimethyl-6-oxo-, (3R,4S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Citrinin
CAS:CitrininFormula:C13H14O5Purity:By hplc: 99.09% (Typical Value in Batch COA)Color and Shape: yellow crystalsMolecular weight:250.25g/molCitrinin (Standard)
CAS:Citrinin (Standard) is the standard substance of Citrinin, and it is applicable for quantitative analysis, quality control, and related research in biochemical experiments. Citrinin is a mycotoxin that causes contamination in the food and is associated with different toxic effects. Citrinin also possesses a broad spectrum of bioactivities, including antifungal, antibacterial, and potential anticancer and neuroprotective effects in vitro.Formula:C13H14O5Molecular weight:250.25Citrinin
CAS:Citrinin: a mycotoxin with antifungal, antibacterial, potential anticancer, and neuroprotective properties; contaminates food.Formula:C13H14O5Purity:98%Color and Shape:Lemon-Yellow Needles From Alc SolidMolecular weight:250.25Citrinin 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C13H14O5Color and Shape:Single SolutionMolecular weight:250.25(-)-Citrinin
CAS:Stability Hygroscopic
Applications Antibiotic substance produced by a white spore aspergilus which has been placed under the species name Aspergillus niveus. Also produced in small quantities by Penicillium citrinum.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Ciegler, A., et al.: Appl. Microbiol., 26, 271 (1973), Creppy, E., et al.: Toxicol. Lett., 28, 29 (1985), DeGroene, E., et al.: Cancer Res., 56, 299 (1996),Formula:C13H14O5Color and Shape:YellowMolecular weight:250.25(-)-Citrinin
CAS:(-)-Citrinin is a mycotoxin, which is a secondary metabolite produced by certain species of fungi, including Penicillium, Aspergillus, and Monascus. It is predominantly isolated from the molds found in grains and other agricultural products. The mode of action of (-)-Citrinin involves the disruption of mitochondrial function, leading to impaired energy metabolism and potential cytotoxic effects. This compound inhibits the activity of various mitochondrial enzymes and disrupts the electron transport chain, which can lead to oxidative stress and cellular damage.Formula:C13H14O5Purity:Min. 95%Molecular weight:250.25 g/mol(-)-Citrinin 4,5-bis(trideuteromethyl)
CAS:Controlled ProductFormula:C13D6H8O5Color and Shape:NeatMolecular weight:256.284







