CymitQuimica logo

CAS 5180-87-0

:

[(2-methylquinolin-8-yl)oxy]acetic acid

Description:
[(2-Methylquinolin-8-yl)oxy]acetic acid, with the CAS number 5180-87-0, is an organic compound characterized by its unique structure that combines a quinoline moiety with an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the quinoline ring suggests potential applications in medicinal chemistry, as quinolines are known for their diverse pharmacological properties, including antimicrobial and antimalarial activities. The ether linkage (–O–) in the structure may also contribute to its stability and reactivity, allowing for various chemical transformations. In terms of physical properties, compounds of this nature often display moderate to high melting points and may be soluble in polar solvents due to the carboxylic acid group. Overall, [(2-methylquinolin-8-yl)oxy]acetic acid represents a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its potential applications and biological effects.
Formula:C12H11NO3
InChI:InChI=1/C12H11NO3/c1-8-5-6-9-3-2-4-10(12(9)13-8)16-7-11(14)15/h2-6H,7H2,1H3,(H,14,15)
SMILES:Cc1ccc2cccc(c2n1)OCC(=O)O
Synonyms:
  • Acetic Acid, 2-[(2-Methyl-8-Quinolinyl)Oxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.