CAS 51802-61-0: (2S,5S)-7-methyl-5-phenyl-5,6-dihydro-2H-1,4-diazepine-2,3-dicarbonitrile

Description:The chemical substance known as (2S,5S)-7-methyl-5-phenyl-5,6-dihydro-2H-1,4-diazepine-2,3-dicarbonitrile, with the CAS number 51802-61-0, is a member of the diazepine family, characterized by a seven-membered ring containing two nitrogen atoms. This compound features a chiral center, indicated by the (2S,5S) configuration, which contributes to its stereochemical properties and potential biological activity. The presence of the methyl and phenyl groups enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The dicarbonitrile functional groups suggest that it may exhibit reactivity typical of nitriles, such as nucleophilic addition or hydrolysis. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological activities. However, specific biological activities, toxicity, and applications would require further investigation through empirical studies and literature review. Overall, its unique structure positions it as a potentially valuable compound for research in organic synthesis and drug development.

Formula:C₁₄H₁₂N₄

InChI:InChI=1/C14H12N4/c1-10-7-12(11-5-3-2-4-6-11)18-14(9-16)13(8-15)17-10/h2-6,12-13H,7H2,1H3/t12-,13+/m0/s1

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-METHYL-7-PHENYL-6,7-DIHYDRO-1H-1,4-DIAZEPINE-2,3-DICARBONITRILE REF: IN-DA00DCVYCAS: 51802-61-0	- - -	To inquire	Thu 17 Apr 25
	7-methyl-5-phenyl-5,6-dihydro-2H-1,4-diazepine-2,3-dicarbonitrile REF: 10-F756995CAS: 51802-61-0	95+%	- - -	Discontinued product