CAS 51803-38-4
:7-Amino-3-methoxy-3-cephem-4-carboxylic acid
Description:
7-Amino-3-methoxy-3-cephem-4-carboxylic acid, identified by its CAS number 51803-38-4, is a synthetic antibiotic compound belonging to the cephem class of beta-lactam antibiotics. This compound features a bicyclic structure characteristic of cephalosporins, which includes a beta-lactam ring essential for its antibacterial activity. The presence of an amino group at the 7-position and a methoxy group at the 3-position contributes to its pharmacological properties, enhancing its efficacy against a range of bacterial pathogens. The carboxylic acid functional group at the 4-position is crucial for solubility and interaction with bacterial enzymes. This compound exhibits broad-spectrum antibacterial activity, making it effective against both Gram-positive and Gram-negative bacteria. Its mechanism of action involves inhibiting bacterial cell wall synthesis, leading to cell lysis and death. Additionally, the structural modifications in this compound may influence its stability, bioavailability, and resistance to beta-lactamases, which are enzymes produced by some bacteria to confer resistance against beta-lactam antibiotics.
Formula:C8H10N2O4S
InChI:InChI=1/C8H10N2O4S/c1-14-3-2-15-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13)/t4?,7-/m1/s1
SMILES:COC1=C(C(=O)O)N2C(=O)C([C@H]2SC1)N
Synonyms:- 7-Amino-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
- 7-Amoca
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
