CAS 518047-31-9
:methyl 5,6-dihydroxypyrimidine-4-carboxylate
Description:
Methyl 5,6-dihydroxypyrimidine-4-carboxylate is a chemical compound characterized by its pyrimidine ring structure, which features two hydroxyl (-OH) groups at the 5 and 6 positions and a carboxylate group (-COOCH3) at the 4 position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often associated with various biological activities. The presence of multiple functional groups allows for further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, the compound may exhibit properties such as antioxidant activity or serve as an intermediate in the synthesis of more complex molecules. As with any chemical substance, safety data should be consulted to understand its handling and potential hazards.
Formula:C6H6N2O4
InChI:InChI=1/C6H6N2O4/c1-12-6(11)3-4(9)5(10)8-2-7-3/h2,9H,1H3,(H,7,8,10)
SMILES:COC(=O)c1c(c(ncn1)O)O
Synonyms:- 4-Pyrimidinecarboxylic Acid, 5,6-Dihydroxy-, Methyl Ester
- 5,6-Dihydroxy-Pyrimidine-4-Carboxylic Acid Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5,6-Dihydroxy-pyrimidine-4-carboxylic acid methyl ester
CAS:5,6-Dihydroxy-pyrimidine-4-carboxylic acid methyl ester (DDC) is an antiviral drug that inhibits the viral enzyme integrase, which is required for viral replication. DDC binds to the active site of the integrase enzyme and prevents it from performing its function in viral replication. This compound has a potentiometric transfer activity and can be used as a probe to study the interactions of metal ions with proteins. DDC has been shown to inhibit HIV-1 infection in vitro by binding to nucleotides and inhibiting RNA synthesis. DDC has also been shown to have medicinal properties, such as reducing cholesterol levels and preventing atherosclerosis.Formula:C6H6N2O4Purity:Min. 95%Molecular weight:170.12 g/mol
