CymitQuimica logo

CAS 51806-20-3

:

Ethane, 1,1-diethoxy-2-iodo-

Description:
Ethane, 1,1-diethoxy-2-iodo- is an organic compound characterized by the presence of two ethoxy groups and an iodine atom attached to a central ethane backbone. Its molecular structure indicates that it is a derivative of ethane, where the ethoxy groups (–O–C2H5) are bonded to the first carbon atom, and an iodine atom is substituted at the second carbon. This compound is likely to exhibit properties typical of alkyl halides, such as moderate polarity due to the presence of the iodine atom, which can influence its reactivity and solubility in various solvents. The ethoxy groups contribute to its potential as a solvent or reagent in organic synthesis. Additionally, the presence of the iodine atom may enhance its reactivity in nucleophilic substitution reactions. Overall, Ethane, 1,1-diethoxy-2-iodo- is a specialized compound that may find applications in chemical synthesis and research, particularly in the development of more complex organic molecules.
Formula:C6H13IO2
InChI:InChI=1S/C6H13IO2/c1-3-8-6(5-7)9-4-2/h6H,3-5H2,1-2H3
InChI key:FWNJFIHTBFQKJD-UHFFFAOYSA-N
SMILES:CCOC(CI)OCC
Found 4 products.