CAS 518070-19-4
:3-Fluoro-5-methylbenzoic acid
Description:
3-Fluoro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group on a benzene ring. The fluorine atom is located at the meta position relative to the carboxylic acid group, while the methyl group is situated at the para position. This compound typically exhibits properties common to benzoic acids, such as being a solid at room temperature with moderate solubility in polar solvents like water due to the carboxylic acid functional group. The presence of the fluorine atom can influence the acidity and reactivity of the compound, potentially enhancing its lipophilicity and altering its interaction with biological systems. Additionally, 3-fluoro-5-methylbenzoic acid may serve as an important intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique structural features can also lead to specific applications in materials science and chemical research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7FO2
InChI:InChI=1S/C8H7FO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=XPUFVYIUPYNLPD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C)=CC(F)=C1
Synonyms:- 3-Fluoro-2-(1,2,4-Oxadiazol-3-Yl)Aniline
- 518070-19-4
- Benzoic acid, 3-fluoro-5-methyl-
- Qvr Cf E1
- 3-Fluoro-5-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-5-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:97%Color and Shape:SolidMolecular weight:154.13843-Fluoro-5-methylbenzoic acid
CAS:3-Fluoro-5-methylbenzoic acidFormula:C8H7FO2Purity:98%Color and Shape: white to off white powderMolecular weight:154.14g/mol3-Fluoro-5-methylbenzoic acid
CAS:3-Fluoro-5-methylbenzoic acid is a sulfilimine that has been shown to have insecticidal, functional, and biological activities. 3-Fluoro-5-methylbenzoic acid binds to the enzyme diamide reductase in insects, which prevents the production of toxic amines in insects. 3-Fluoro-5-methylbenzoic acid also inhibits the synthesis of anthranilic acid and organosulfur compounds in plants. This sulfilimine is structurally similar to other insecticides such as DDT and carbofuran. It is soluble in water but insoluble in organic solvents.Formula:C8H7FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.14 g/mol3-Fluoro-5-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:97%Color and Shape:SolidMolecular weight:154.14



