CAS 518070-24-1
:2-Cyano-5-fluorobenzoic acid
Description:
2-Cyano-5-fluorobenzoic acid is an aromatic compound characterized by the presence of a cyano group (-CN) and a fluorine atom attached to a benzoic acid structure. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The cyano group contributes to the compound's polarity and can enhance its reactivity in nucleophilic substitution reactions. The fluorine atom, being highly electronegative, can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological systems. 2-Cyano-5-fluorobenzoic acid is often utilized in organic synthesis and pharmaceutical research due to its unique structural features, which may serve as intermediates in the development of biologically active compounds. Additionally, its solubility characteristics can vary based on the solvent used, making it important to consider in practical applications. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to a benzoic acid framework.
Formula:C8H4FNO2
InChI:InChI=1/C8H4FNO2/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3H,(H,11,12)
SMILES:c1cc(cc(c1C#N)C(=O)O)F
Synonyms:- Benzoic Acid, 2-Cyano-5-Fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2-cyano-5-fluoro- (9CI)
CAS:Formula:C8H4FNO2Purity:95%Color and Shape:SolidMolecular weight:165.12132-Cyano-5-fluorobenzoic acid
CAS:2-Cyano-5-fluorobenzoic acid (2C5FBA) is a chemical that is synthesized by the reaction of sodium nitrite with methyl ester. It can be used in organic synthesis as a target product and can also be used as an intermediate for the synthesis of other chemicals. 2C5FBA has been shown to react with nitrogen to produce cyanide, which is toxic to humans and animals. 2C5FBA also reacts with acid methyl to produce methyl esters, which are often used as solvents in industrial settings.
Formula:C8H4FNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:165.12 g/mol



