CAS 51814-54-1

benzyl N-(tert-butoxycarbonyl)-L-alaninate

Description:

Benzyl N-(tert-butoxycarbonyl)-L-alaninate is an organic compound characterized by its structure, which includes a benzyl group, a tert-butoxycarbonyl (Boc) protecting group, and the amino acid L-alanine. This compound is typically used in peptide synthesis and as an intermediate in organic synthesis due to the stability provided by the Boc group, which can be selectively removed under mild acidic conditions. The presence of the benzyl group enhances its lipophilicity, making it more soluble in organic solvents. The compound is generally white to off-white in appearance and may exhibit a crystalline form. Its molecular structure allows for various functional group transformations, making it versatile in synthetic chemistry. Additionally, it is important to handle this compound with care, following appropriate safety protocols, as it may have specific hazards associated with its use. Overall, benzyl N-(tert-butoxycarbonyl)-L-alaninate serves as a valuable building block in the synthesis of more complex molecules, particularly in the field of medicinal chemistry and drug development.

Formula: C₁₅H₂₁NO₄

InChI: InChI=1/C15H21NO4/c1-11(16-14(18)20-15(2,3)4)13(17)19-10-12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3,(H,16,18)/t11-/m0/s1

SMILES: C[C@@H](C(=O)OCc1ccccc1)N=C(O)OC(C)(C)C

Synonyms:

• Boc-Ala-Obzl

BOC-ALA-OBZL

CAS: 51814-54-1

Formula: C₁₅H₂₁NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 279.3315

Ref: IN-DA00DA43

Boc-L-Alanine Benzyl Ester

CAS: 51814-54-1

Boc-L-Alanine Benzyl Ester

Purity: 97%

Molecular weight: 279.33g/mol

Ref: 54-OR1012520

Boc-L-alanine benzylester

CAS: 51814-54-1

Boc-L-alanine benzylester is a novel fluorescent crosslinker that can be used to synthesize fluorescent polymers. It is composed of an acid moiety and benzothiadiazole moieties, which are catalytic. The synthesis of Boc-L-alanine benzylester involves the reaction of lysine or tyrosine with an acid chloride to form an amide bond, followed by a ring opening reaction with the corresponding benzothiadiazole. The fluorescein group is then added as a substituent at the N-terminus. This new crosslinker has been shown to have high reactivity in cycloadditions and crosslinking reactions with anthracene, cyclopentadiene, and cyclohexadiene. Boc-L-alanine benzylester has also been shown to be effective in ascorbate oxidation.

Formula: C₁₅H₂₁NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 279.33 g/mol

Ref: 3D-FB11931

Boc-L-alanine benzyl ester

CAS: 51814-54-1

Formula: C₁₅H₂₁NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 279.336

Ref: 10-F078598