CAS 51828-54-7

1-(4-chlorophenyl)sulfanylbutan-2-one

Description:

1-(4-Chlorophenyl)sulfanylbutan-2-one, with the CAS number 51828-54-7, is an organic compound characterized by its unique structure, which includes a butanone backbone substituted with a 4-chlorophenyl group and a sulfanyl (thioether) functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chlorophenyl group may impart specific electronic and steric properties, influencing its reactivity and interactions with biological targets. Additionally, the sulfanyl group can enhance the compound's nucleophilicity, making it useful in various chemical reactions. Safety data should be consulted, as compounds with halogenated aromatic groups can exhibit toxicity or environmental concerns. Overall, 1-(4-chlorophenyl)sulfanylbutan-2-one is a compound of interest in both research and industrial applications, warranting careful handling and study.

Formula: C₁₀H₁₁ClOS

InChI: InChI=1/C10H11ClOS/c1-2-9(12)7-13-10-5-3-8(11)4-6-10/h3-6H,2,7H2,1H3

SMILES: CCC(=O)CSc1ccc(cc1)Cl

1-[(4-Chlorophenyl)sulfanyl]butan-2-one

CAS: 51828-54-7

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClOS

Purity: Min. 95%

Molecular weight: 214.71 g/mol

Ref: 3D-BCA82854