CAS 518285-56-8

N-(4-Methylphenyl)-4-piperidinamine

Description:

N-(4-Methylphenyl)-4-piperidinamine, also known by its CAS number 518285-56-8, is an organic compound characterized by its piperidine structure, which includes a piperidine ring substituted with an amine group and a 4-methylphenyl group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including alkylation and acylation. Its molecular structure suggests potential applications in drug development, particularly in the fields of neuropharmacology and medicinal chemistry, where modifications to the piperidine or phenyl groups can lead to compounds with enhanced efficacy or selectivity. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c1-10-2-4-11(5-3-10)14-12-6-8-13-9-7-12/h2-5,12-14H,6-9H2,1H3

InChI key: InChIKey=RUDYFATVFHYYBS-UHFFFAOYSA-N

SMILES: N(C1=CC=C(C)C=C1)C2CCNCC2

Synonyms:

• 4-Piperidinamine, N-(4-methylphenyl)-
• N-(4-Methylphenyl)-4-piperidinamine
• 4-(4-Methylanilino)piperidine

N-(4-Methylphenyl)piperidin-4-amine

Controlled Product

CAS: 518285-56-8

Versatile small molecule scaffold

Formula: C₁₂H₁₈N₂

Purity: Min. 95%

Molecular weight: 190.28 g/mol

Ref: 3D-TVA28556