CAS 51832-31-6
:Dimethyl 4-aminophthalate
Description:
Dimethyl 4-aminophthalate, with the CAS number 51832-31-6, is an organic compound that belongs to the class of phthalate esters. It is characterized by the presence of two methyl groups and an amino group attached to a phthalate structure, which contributes to its chemical properties. This compound typically appears as a crystalline solid and is soluble in organic solvents, while exhibiting limited solubility in water. Dimethyl 4-aminophthalate is often utilized in various applications, including as an intermediate in the synthesis of dyes, pigments, and pharmaceuticals. Its chemical structure allows it to participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, it may exhibit specific optical properties, which can be advantageous in certain applications. As with many chemical substances, handling precautions should be observed due to potential toxicity or environmental impact, necessitating proper safety measures during use and disposal.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-14-9(12)7-4-3-6(11)5-8(7)10(13)15-2/h3-5H,11H2,1-2H3
InChI key:InChIKey=NTBHQNDXAJXRPU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C(OC)=O)C=CC(N)=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, 4-amino-, 1,2-dimethyl ester
- 1,2-Benzenedicarboxylic acid, 4-amino-, dimethyl ester
- 4-Amino-1,2-benzenedicarboxylic acid dimethyl ester
- Ai3-14780
- Dimethyl 4-Aminobenzene-1,2-Dicarboxylate
- Dimethyl 5-amino-1,2-benzenedicarboxylate
- Methyl 2-methoxycarbonyl-4-aminobenzoate
- NSC 41699
- Phthalic acid, 4-amino-, dimethyl ester
- Dimethyl 4-aminophthalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Dimethyl 4-aminophthalate
CAS:Formula:C10H11NO4Purity:98%Color and Shape:SolidMolecular weight:209.1986Dimethyl 4-aminophthalate
CAS:Formula:C10H11NO4Purity:95%Color and Shape:SolidMolecular weight:209.2014-Aminophthalic acid dimethyl ester
CAS:4-Aminophthalic acid dimethyl ester is a product of the reaction between p-hydroxybenzoic acid and phosphorus pentachloride. It is used in analytical methods to determine the amount of 4-aminophthalic acid in an unknown sample. This product reacts with polyclonal antibodies against 4-aminophthalic acid, which are attached to a solid support, forming an antigen-antibody complex. The amount of 4-aminophthalic acid present can be determined by measuring the extent of the colour change that occurs when hydrochloric acid is added to the mixture.
Formula:C10H11NO4Purity:Min. 95%Color and Shape:SolidMolecular weight:209.2 g/mol



