CymitQuimica logo

CAS 51832-85-0

:

3,5-dimethyl-N-(pyridin-2-ylmethyl)benzamide

Description:
3,5-Dimethyl-N-(pyridin-2-ylmethyl)benzamide is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a benzamide structure with two methyl groups located at the 3 and 5 positions of the aromatic ring, contributing to its hydrophobic character. The presence of a pyridin-2-ylmethyl substituent introduces a nitrogen-containing heterocyclic moiety, which can enhance the compound's biological activity and solubility in polar solvents. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are influenced by its molecular weight and functional groups. Its CAS number, 51832-85-0, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, this compound's unique structure and functional groups position it as a candidate for further investigation in chemical and biological studies.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c1-11-7-12(2)9-13(8-11)15(18)17-10-14-5-3-4-6-16-14/h3-9H,10H2,1-2H3,(H,17,18)
Synonyms:
  • benzamide, 3,5-dimethyl-N-(2-pyridinylmethyl)-
  • 3,5-Dimethyl-N-(pyridin-2-ylmethyl)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.