CymitQuimica logo

CAS 51833-69-3

:

N-methylglycyl-N~5~-(diaminomethylidene)ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine

Description:
N-methylglycyl-N~5~-(diaminomethylidene)ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine, with CAS number 51833-69-3, is a complex peptide that features a sequence of amino acids, including both standard and modified residues. This compound is characterized by its intricate structure, which includes a combination of hydrophilic and hydrophobic regions, influencing its solubility and interaction with biological systems. The presence of the N-methyl group and the diaminomethylidene moiety suggests potential for enhanced stability and bioactivity. Peptides like this one often exhibit specific biological functions, such as acting as signaling molecules or influencing metabolic pathways. Its synthesis typically involves solid-phase peptide synthesis techniques, allowing for precise control over the sequence and modifications. The compound's properties, including its molecular weight, solubility, and reactivity, are determined by the arrangement of its constituent amino acids and any functional groups present. Overall, this peptide represents a fascinating area of study in biochemistry and pharmacology, with potential applications in therapeutic development.
Formula:C49H71N13O10
InChI:InChI=1/C49H71N13O10/c1-6-29(4)41(46(69)58-36(24-32-25-53-27-55-32)47(70)62-21-11-15-38(62)44(67)59-37(48(71)72)23-30-12-8-7-9-13-30)61-43(66)35(22-31-16-18-33(63)19-17-31)57-45(68)40(28(2)3)60-42(65)34(56-39(64)26-52-5)14-10-20-54-49(50)51/h7-9,12-13,16-19,25,27-29,34-38,40-41,52,63H,6,10-11,14-15,20-24,26H2,1-5H3,(H,53,55)(H,56,64)(H,57,68)(H,58,69)(H,59,67)(H,60,65)(H,61,66)(H,71,72)(H4,50,51,54)/t29-,34?,35-,36-,37-,38-,40-,41-/m0/s1
InChI key:WCYZYYURIHACQW-PEFVFWBQSA-N
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N=C([C@H](Cc1ccc(cc1)O)N=C([C@H](C(C)C)N=C(C(CCCNC(=N)N)N=C(CNC)O)O)O)O
Synonyms:
  • (Sar1)-Angiotensin II
  • Sar-Arg-Val-Tyr-Ile-His-Pro-Phe-OH
Found 4 products.