CymitQuimica logo

CAS 518336-20-4

:

[4-(1-Hydroxyethyl)phenyl]boronic acid

Description:
[4-(1-Hydroxyethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a hydroxyethyl substituent. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl group. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols and sugars, making it useful in various applications such as organic synthesis, medicinal chemistry, and as a reagent in the development of sensors. The presence of the hydroxyethyl group enhances its reactivity and solubility, facilitating its use in coupling reactions and as a building block in the synthesis of more complex molecules. Additionally, boronic acids are known for their role in the Suzuki-Miyaura cross-coupling reaction, which is a key method in the formation of carbon-carbon bonds in organic chemistry.
Formula:C8H11BO3
InChI:InChI=1S/C8H11BO3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6,10-12H,1H3
InChI key:QORATNLZEOZUPG-UHFFFAOYSA-N
SMILES:CC(c1ccc(cc1)B(O)O)O
Synonyms:
  • 4-(1-Hydroxyethyl)Phenylboronic Acid
  • (4-(1-Hydroxyethyl)phenyl)boronic acid
Found 5 products.