CAS 518357-38-5

5-Ethyl-1H-pyrazole-3-carboxaldehyde

Description:

5-Ethyl-1H-pyrazole-3-carboxaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl group at the 5-position and an aldehyde functional group at the 3-position of the pyrazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group makes it a versatile intermediate for further chemical transformations, such as condensation reactions and the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and stability in different solvents. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Overall, 5-Ethyl-1H-pyrazole-3-carboxaldehyde is a valuable compound in the field of organic chemistry and potentially in pharmaceutical development.

Formula: C₆H₈N₂O

InChI: InChI=1S/C6H8N2O/c1-2-5-3-6(4-9)8-7-5/h3-4H,2H2,1H3,(H,7,8)

InChI key: InChIKey=YJDHAJGVDHPKGV-UHFFFAOYSA-N

SMILES: C(C)C1=CC(C=O)=NN1

Synonyms:

• 1H-Pyrazole-3-carboxaldehyde, 5-ethyl-
• 5-Ethyl-2H-pyrazole-3-carboxaldehyde
• 5-Ethyl-1H-pyrazole-3-carboxaldehyde
• 3-Ethyl-1H-pyrazole-5-carbaldehyde

3-ethyl-1H-pyrazole-5-carbaldehyde

CAS: 518357-38-5

Formula: C₆H₈N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 124.143

Ref: 10-F312714