CAS 518357-51-2

5-[amino(carboxy)methyl]-4-methylthiophene-2-carboxylic acid

Description:

5-[Amino(carboxy)methyl]-4-methylthiophene-2-carboxylic acid, identified by its CAS number 518357-51-2, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features multiple functional groups, including an amino group and two carboxylic acid groups, which contribute to its potential as a versatile building block in organic synthesis and pharmaceutical applications. The presence of the methyl group enhances its hydrophobic characteristics, while the carboxylic acid groups increase its polarity and solubility in polar solvents. The amino group can participate in various chemical reactions, making this compound useful in the synthesis of more complex molecules. Additionally, the thiophene moiety is known for its electronic properties, which can be advantageous in materials science and organic electronics. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₈H₉NO₄S

InChI: InChI=1/C8H9NO4S/c1-3-2-4(7(10)11)14-6(3)5(9)8(12)13/h2,5H,9H2,1H3,(H,10,11)(H,12,13)

SMILES: Cc1cc(C(=O)O)sc1C(C(=O)O)N

Synonyms:

• 2-Thiopheneacetic acid, alpha-amino-5-carboxy-3-methyl-
• 5-[Amino(carboxy)methyl]-4-methylthiophene-2-carboxylic acid

5-[amino(carboxy)methyl]-4-methylthiophene-2-carboxylic acid

CAS: 518357-51-2

Formula: C₈H₉NO₄S

Purity: 95%

Molecular weight: 215.2264

Ref: IN-DA0037Q5

3-MATIDA

CAS: 518357-51-2

3-MATIDA

Purity: ≥98%

Molecular weight: 215.23g/mol

Ref: 54-BUP15380

3-MATIDA

CAS: 518357-51-2

3-MATIDA is an effective mGluR-1 antagonist (IC50: 6.3 μM, rat mGluR-1a).

Formula: C₈H₉NO₄S

Purity: 99.75% - 99.96%

Color and Shape: Solid

Molecular weight: 215.23

Ref: TM-T3486