CymitQuimica logo

CAS 51843-14-2

:

1,2-dimethyl-1,2-dihydroisoquinoline

Description:
1,2-Dimethyl-1,2-dihydroisoquinoline is an organic compound that belongs to the class of isoquinolines, which are bicyclic compounds containing a fused benzene and pyridine ring. This particular compound features two methyl groups attached to the first and second carbon atoms of the dihydroisoquinoline structure, which contributes to its unique chemical properties. It is typically characterized by its molecular formula, which reflects the presence of carbon, hydrogen, and nitrogen atoms. The compound is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various chemical reactions, including oxidation and substitution, which can be exploited in synthetic applications. Additionally, 1,2-dimethyl-1,2-dihydroisoquinoline may exhibit specific physical properties such as solubility in organic solvents and distinct melting or boiling points, although these can vary based on purity and environmental conditions. Overall, this compound serves as a valuable building block in organic synthesis and pharmaceutical research.
Formula:C11H13N
InChI:InChI=1/C11H13N/c1-9-11-6-4-3-5-10(11)7-8-12(9)2/h3-9H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.