CAS 51857-11-5
:Sternbin
Description:
Sternbin, identified by the CAS number 51857-11-5, is a chemical compound that belongs to the class of organic substances. It is characterized by its specific molecular structure, which influences its physical and chemical properties. Typically, compounds like Sternbin may exhibit characteristics such as solubility in organic solvents, stability under standard conditions, and potential reactivity with various functional groups. The compound may also have applications in fields such as pharmaceuticals, agrochemicals, or materials science, depending on its functional groups and reactivity. Its safety profile, including toxicity and environmental impact, would be assessed through standard toxicological studies. As with any chemical substance, proper handling and storage protocols are essential to ensure safety and compliance with regulatory guidelines. For detailed information regarding its specific applications, safety data, and regulatory status, consulting specialized databases or scientific literature is recommended.
Formula:C16H14O6
InChI:InChI=1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1
InChI key:InChIKey=DSAJORLEPQBKDA-AWEZNQCLSA-N
SMILES:O=C1C=2C(O[C@@H](C1)C3=CC(O)=C(O)C=C3)=CC(OC)=CC2O
Synonyms:- (2S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-5-hydroxy-7-methoxy-, (2S)-
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-5-hydroxy-7-methoxy-, (S)-
- 51857-11-5
- 7-Methyleriodictyol
- 7-O-Methyleriodictyol
- Eriodictyol 7-methyl ether
- Sternbin
- Sterubin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Sterubin
CAS:Sterubin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H14O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:302.287-O-Methyleriodictyol
CAS:7-O-Methyleriodictyol is a flavanone isolated from Artemisia monosperma and shows biological effects on rat isolated smooth muscles.Formula:C16H14O6Purity:98.10%Color and Shape:SolidMolecular weight:302.287-O-Methyleriodictyol
CAS:Formula:C16H14O6Purity:95%~99%Color and Shape:PowderMolecular weight:302.2827-O-Methyleriodictyol
CAS:<p>7-O-Methyleriodictyol is a naturally occurring flavonoid, which is a type of plant-derived polyphenolic compound. This compound is predominantly sourced from the plant Eriodictyon californicum, commonly known as yerba santa. The mode of action of 7-O-Methyleriodictyol involves its ability to scavenge free radicals, a property attributed to its antioxidant activity. This action helps in the stabilization of reactive oxygen species (ROS), thereby protecting cells from oxidative stress and potential subsequent damage.</p>Formula:C16H14O6Purity:Min. 95%Color and Shape:PowderMolecular weight:302.28 g/mol





