CAS 51857-17-1: N-BOC-1,6-diaminohexane
Description:N-BOC-1,6-diaminohexane, also known as tert-butoxycarbonyl-1,6-diaminohexane, is an organic compound characterized by the presence of two amino groups (-NH2) and a tert-butoxycarbonyl (BOC) protecting group. This compound features a hexane backbone, which contributes to its aliphatic nature. The BOC group is commonly used in organic synthesis to protect amines during chemical reactions, allowing for selective functionalization. N-BOC-1,6-diaminohexane is typically a white to off-white solid and is soluble in polar organic solvents. Its structure allows for potential applications in peptide synthesis and drug development, particularly in the formation of amide bonds. The presence of two amino groups makes it a versatile building block for creating more complex molecules. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including acylation and coupling reactions. Proper handling and storage are essential due to its reactivity and potential hazards associated with amines.
Formula:C11H24N2O2
InChI:InChI=1S/C11H24N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8-12/h4-9,12H2,1-3H3,(H,13,14)
InChI key:InChIKey=RVZPDKXEHIRFPM-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NCCCCCCN
- Synonyms:
- (6-Aminohexyl)carbamic acid tert-butyl ester
- 1-((tert-Butoxycarbonyl)amino)-6-aminohexane
- 6-((tert-Butoxycarbonyl)amino)-1-hexylamine
- 6-(tert-Butoxycarbonyl)amino-1-aminohexane
- 6-(tert-Butoxycarbonylamino)-1-hexanamine
- 6-(tert-Butoxycarbonylamino)hexylamine
- 6-Aminohexylcarbamic acid tert-butyl ester
- 6-[(Tert-Butoxycarbonyl)Amino]Hexan-1-Aminium
- 6-[(tert-Butyloxycarbonyl)amino]hexylamine
- Boc-1,6-hexanediamine
- See more synonyms
- Carbamic acid, (6-aminohexyl)-, 1,1-dimethylethyl ester
- Carbamic acid, N-(6-aminohexyl)-, 1,1-dimethylethyl ester
- Mono-BOC-hexamethylenediamine
- N-(tert-Butoxycarbonyl)-1,6-diaminohexane
- N-(tert-Butoxycarbonyl)hexamethylenediamine
- N-Boc-1,6-Hexanediamine
- N-Boc-1,6-diaminohexane
- Tert-Butyl (6-Aminohexyl)Carbamate
- tert-Butyl N-(6-aminohexyl)carbamate
- tert-Butyloxycarbonyl-1,6-hexamethylenediamine
- N-(tert-Butoxycarbonyl)-1,6-hexanediamine
