CymitQuimica logo

CAS 51857-41-1

:

4-bromo-2,3,6-trimethylphenol

Description:
4-Bromo-2,3,6-trimethylphenol, with the CAS number 51857-41-1, is an organic compound that belongs to the class of phenols. This substance features a bromine atom and three methyl groups attached to a phenolic ring, which significantly influences its chemical properties and reactivity. It is typically characterized by its solid state at room temperature, exhibiting a distinct aromatic odor. The presence of the bromine atom enhances its potential for electrophilic substitution reactions, while the methyl groups contribute to its hydrophobic character and influence its solubility in organic solvents. This compound is often utilized in various applications, including as an intermediate in organic synthesis and potentially in the formulation of certain materials due to its antimicrobial properties. Additionally, its structure allows for potential applications in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with many brominated compounds, it may pose environmental and health risks.
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c1-5-4-8(10)6(2)7(3)9(5)11/h4,11H,1-3H3
InChI key:CNZUMQRUUPCHJR-UHFFFAOYSA-N
SMILES:Cc1cc(c(C)c(C)c1O)Br
Synonyms:
  • 4-Bromo-2,3,6-trimethyl-phenol
  • Phenol, 4-Bromo-2,3,6-Trimethyl-
Found 4 products.