CAS 51859-60-0

2-(furan-2-yl)-1,3-thiazolidine

Description:

2-(Furan-2-yl)-1,3-thiazolidine is a heterocyclic organic compound characterized by the presence of both a furan ring and a thiazolidine structure. The furan moiety contributes to its aromatic properties, while the thiazolidine ring introduces sulfur and nitrogen into the molecular framework, enhancing its reactivity and potential biological activity. This compound typically exhibits a moderate polarity due to the presence of heteroatoms, which can influence its solubility in various solvents. It may participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, owing to the electron-rich nature of the furan ring and the electrophilic character of the thiazolidine. Additionally, compounds of this type are of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial and anti-inflammatory activities. The specific interactions and stability of 2-(furan-2-yl)-1,3-thiazolidine can be influenced by substituents on the furan or thiazolidine rings, making it a versatile scaffold for further chemical modifications and applications in drug development.

Formula: C₇H₉NOS

InChI: InChI=1/C7H9NOS/c1-2-6(9-4-1)7-8-3-5-10-7/h1-2,4,7-8H,3,5H2

SMILES: c1cc(C2NCCS2)oc1

Synonyms:

• 2-(2-Furyl)-1,3-thiazolidine
• Thiazolidine, 2-(2-furanyl)-

2-(Furan-2-yl)-1,3-thiazolidine

CAS: 51859-60-0

2-(Furan-2-yl)-1,3-thiazolidine is a chemical compound that is used as a reagent in organic synthesis. It has been shown to be an efficient sulfur-promoted atom transfer agent for the aerobic oxidation of thiols, such as cysteine. 2-(Furan-2-yl)-1,3-thiazolidine has also been studied as a catalyst in the formation of microemulsions. The catalytic activity of this molecule may be enhanced by its ability to form structured intermediates at the interface between water and oil phases. This reaction product is stable enough to withstand repeated phase changes and can be used for the production of glycols from diols.

Formula: C₇H₉NOS

Purity: Min. 95%

Molecular weight: 155.22 g/mol

Ref: 3D-BCA85960