CAS 51859-95-1

[(3-Bromophenyl)methyl]hydrazine

Description:

[(3-Bromophenyl)methyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a 3-bromophenylmethyl moiety. This compound features a bromine atom substituted on the aromatic ring, which can influence its reactivity and physical properties. Typically, compounds like this exhibit moderate to high polarity due to the presence of the hydrazine group, which can engage in hydrogen bonding. The bromine substituent may enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the hydrazine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazines are known for their biological activity. Safety considerations are important, as hydrazines can be toxic and potentially carcinogenic. Therefore, handling this compound requires appropriate safety measures, including the use of personal protective equipment and working in a well-ventilated area or fume hood.

Formula: C₇H₉BrN₂

InChI: InChI=1S/C7H9BrN2/c8-7-3-1-2-6(4-7)5-10-9/h1-4,10H,5,9H2

InChI key: InChIKey=VUJAAGDKMIUIFQ-UHFFFAOYSA-N

SMILES: C(NN)C1=CC(Br)=CC=C1

Synonyms:

• [(3-Bromophenyl)methyl]hydrazine
• 3-Bromobenzylhydrazine
• Hydrazine, [(3-bromophenyl)methyl]-

3-BROMOBENZYLHYDRAZINE

CAS: 51859-95-1

Formula: C₇H₉BrN₂

Purity: 95.0%

Molecular weight: 201.067

Ref: 10-F501850