CAS 51868-46-3
:N-[2-[2-(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-(di-2-propen-1-ylamino)-4-methoxyphenyl]acetamide
Description:
N-[2-[2-(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-(di-2-propen-1-ylamino)-4-methoxyphenyl]acetamide, with the CAS number 51868-46-3, is a synthetic organic compound characterized by its complex structure, which includes a diazenyl group and multiple functional moieties. This compound features a bromo-substituted dinitrophenyl group, contributing to its potential reactivity and applications in various fields, including dye chemistry and materials science. The presence of the di-2-propen-1-ylamino group suggests potential for polymerization or other chemical transformations, while the methoxy group may influence its solubility and electronic properties. The acetamide functional group indicates that it may exhibit biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structural features and functional groups suggest a range of potential applications, though specific properties such as solubility, stability, and reactivity would need to be evaluated in detail for practical use.
Formula:C21H21BrN6O6
InChI:InChI=1S/C21H21BrN6O6/c1-5-7-26(8-6-2)18-11-16(23-13(3)29)17(12-20(18)34-4)24-25-21-15(22)9-14(27(30)31)10-19(21)28(32)33/h5-6,9-12H,1-2,7-8H2,3-4H3,(H,23,29)
InChI key:InChIKey=WXDXQSMFRITTEJ-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=C(OC)C=C(N=NC2=C(N(=O)=O)C=C(N(=O)=O)C=C2Br)C(NC(C)=O)=C1
Synonyms:- Acetamide, N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(di-2-propenylamino)-4-methoxyphenyl]-
- Acetamide, N-[2-[2-(2-bromo-4,6-dinitrophenyl)diazenyl]-5-(di-2-propen-1-ylamino)-4-methoxyphenyl]-
- Disperse Blue 291G
- N-[2-[2-(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-(di-2-propen-1-ylamino)-4-methoxyphenyl]acetamide
- N-{2-[(E)-(2-bromo-4,6-dinitrophenyl)diazenyl]-5-(diprop-2-en-1-ylamino)-4-methoxyphenyl}acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Disperse Blue 373 (Technical Grade)
CAS:Controlled Product<p>Applications Disperse Blue 373 have adverse effect on soil and water environment and is a major mutagen in environmental system. This dye is released by textile industry<br>References Watanabe, T., et al.: Env. Sci (Tokyo, Japan), 12, 356 (2005);Carneiro, P.A., et. al.: J. Hazardous Mat., 174, 694 (2010);<br></p>Formula:C21H21BrN6O6Color and Shape:NeatMolecular weight:533.332
