CAS 51873-95-1

[C(Z)]-3-Bromobenzaldehyde oxime

Description:

[C(Z)]-3-Bromobenzaldehyde oxime, with the CAS number 51873-95-1, is an organic compound characterized by the presence of a bromobenzaldehyde moiety and an oxime functional group. This compound features a bromine atom attached to the aromatic ring at the meta position relative to the aldehyde group, which influences its reactivity and properties. The oxime functional group, formed by the reaction of the aldehyde with hydroxylamine, imparts specific characteristics such as the ability to form stable derivatives and participate in various chemical reactions, including condensation and rearrangement. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the bromine atom can enhance the compound's electrophilicity, making it a useful intermediate in further chemical transformations. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₆BrNO

InChI: InChI=1S/C7H6BrNO/c8-7-3-1-2-6(4-7)5-9-10/h1-5,10H/b9-5-

InChI key: InChIKey=DBGBMIPNNIZQNN-UITAMQMPSA-N

SMILES: C(=N\O)\C1=CC(Br)=CC=C1

Synonyms:

• 3-Bromobenzaldoxime
• Benzaldehyde, 3-bromo-, oxime, (Z)-
• Benzaldehyde, 3-bromo-, oxime, [C(Z)]-
• [C(Z)]-3-Bromobenzaldehyde oxime
• anti-m-Bromobenzaldoxime

3-Bromobenzaldehyde oxime

CAS: 51873-95-1

Formula: C₇H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.0326

Ref: IN-DA003J40

3-Bromobenzaldoxime

CAS: 51873-95-1

3-Bromobenzaldoxime

Purity: 98%

Molecular weight: 200.03g/mol

Ref: 54-OR1026802