CymitQuimica logo

CAS 51885-81-5

:

Benzoic acid, 4-acetyl-3-nitro-, methyl ester

Description:
Benzoic acid, 4-acetyl-3-nitro-, methyl ester, with the CAS number 51885-81-5, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a nitro group and an acetyl group attached to the benzene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a crystalline structure. The presence of the nitro group often imparts significant polarity, affecting its solubility in various solvents; it is generally soluble in organic solvents but may have limited solubility in water. The compound may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its reactivity can be influenced by the functional groups present, making it a candidate for further chemical transformations. Safety data should be consulted, as compounds with nitro groups can sometimes be hazardous. Overall, this compound exemplifies the complexity and diversity of organic chemistry.
Formula:C10H9NO5
InChI:InChI=1S/C10H9NO5/c1-6(12)8-4-3-7(10(13)16-2)5-9(8)11(14)15/h3-5H,1-2H3
InChI key:RWLGQQWVBIMMEG-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-]
Found 4 products.