CAS 518990-32-4

4-Fluoro-3-iodo-1H-indazole

Description:

4-Fluoro-3-iodo-1H-indazole is a heterocyclic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of fluorine and iodine substituents at the 4 and 3 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity due to the halogen substituents, which can enhance its biological activity and interaction with various targets. It is often studied in medicinal chemistry for its potential applications in drug development, particularly in the fields of oncology and neurology. The compound may also display interesting electronic properties due to the presence of the halogens, which can affect its absorption and emission characteristics. Additionally, 4-Fluoro-3-iodo-1H-indazole can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Its stability and solubility characteristics are influenced by the specific functional groups and their positions on the indazole framework.

Formula: C₇H₄FIN₂

InChI: InChI=1/C7H4FIN2/c8-4-2-1-3-5-6(4)7(9)11-10-5/h1-3H,(H,10,11)

SMILES: c1cc(c2c(c1)[nH]nc2I)F

Synonyms:

• 1H-Indazole, 4-fluoro-3-iodo-
• 4-Fluoro-3-iodo-1H-indazole

4-Fluoro-3-iodo-1H-indazole

CAS: 518990-32-4

Formula: C₇H₄FIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 262.0229

Ref: IN-DA00DE0X

4-Fluoro-3-iodo-1H-indazole

CAS: 518990-32-4

4-Fluoro-3-iodo-1H-indazole

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.02g/mol

Ref: 54-PC8397

4-Fluoro-3-iodo-1H-indazole

CAS: 518990-32-4

Formula: C₇H₄FIN₂

Purity: 98%

Color and Shape: Solid, Yellow solid

Molecular weight: 261.94

Ref: 10-F036384