CAS 519-05-1
:6-Formyl-2,3-dimethoxybenzoic acid
Description:
6-Formyl-2,3-dimethoxybenzoic acid, with the CAS number 519-05-1, is an organic compound that belongs to the class of benzoic acids. It features a formyl group (-CHO) and two methoxy groups (-OCH3) attached to a benzene ring, specifically at the 2 and 3 positions relative to the carboxylic acid group. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. It is typically a white to off-white crystalline solid, soluble in organic solvents, and exhibits moderate solubility in water due to the presence of the carboxylic acid group. The presence of the formyl group makes it a potential precursor for various chemical reactions, including condensation and substitution reactions. Additionally, the methoxy groups can influence the compound's electronic properties and reactivity, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H10O5
InChI:InChI=1S/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=HVXXOIGTXJOVON-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C(OC)=CC=C1C=O
Synonyms:- 2,3-Dimethoxy-6-formylbenzoic acid
- 5,6-Dimethoxy-2-formylbenzoic acid
- 5,6-Dimethoxyphthalaldehydic acid
- 5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid
- 6-Formyl-2,3-Dimethoxybenzoic Acid
- Benzoic acid, 6-formyl-2,3-dimethoxy-
- NSC 35546
- Opianic acid
- Phthalaldehydic acid, 5,6-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Formyl-2,3-dimethoxybenzoic acid
CAS:Formula:C10H10O5Purity:98%Color and Shape:SolidMolecular weight:210.1834Noscapine Impurity 5 (Opianic Acid) (Mixture of Tautomeric Isomers)
CAS:Formula:C10H10O5Color and Shape:White To Off-White SolidMolecular weight:210.196-Formyl-2,3-dimethoxybenzoic acid
CAS:6-Formyl-2,3-dimethoxybenzoic acidPurity:≥95%Molecular weight:210.18g/molOpianic Acid
CAS:Applications Opianic Acid is a reagent used in the synthesis of novel 5-arylidene (thio)barbituric acid displaying urease activity.
References Vosooghi, M. et al.: J. Iran. Chem. Soc., 12, 1487 (2015);Formula:C10H10O5Color and Shape:White SolidMolecular weight:210.182-Carboxy-3,4-dimethoxybenzaldehyde
CAS:2-Carboxy-3,4-dimethoxybenzaldehyde is a chemical that belongs to the class of compounds known as butyric acid derivatives. It is a colorless liquid with a pungent odor and can be used in pharmaceutical preparations as an antispasmodic or a sedative. 2-Carboxy-3,4-dimethoxybenzaldehyde has been shown to have radical scavenging activities in tissue culture systems and dry weight reaction products in the presence of hydrochloric acid and chloride ion. This compound can also act as an acid complexing agent for hydrogen chloride and depressant activity on animal behavior.Formula:C10H10O5Purity:Min. 95%Color and Shape:White Yellow PowderMolecular weight:210.18 g/mol





