CAS 5190-68-1

4-Chloroquinazoline

Description:

4-Chloroquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the fourth position of the quinazoline ring significantly influences its chemical properties and reactivity. This compound is typically a white to light yellow crystalline solid and is known for its role in medicinal chemistry, particularly as a scaffold for the development of various pharmaceuticals. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. 4-Chloroquinazoline can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile intermediate in organic synthesis. Its derivatives have been studied for potential applications in treating diseases such as cancer and infectious diseases due to their biological activity. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure.

Formula: C₈H₅ClN₂

InChI: InChI=1/C8H5ClN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H

SMILES: c1ccc2c(c1)c(Cl)ncn2

Synonyms:

• 4-Chlorchinazolin
• Quinazoline, 4-chloro-
• 4-Chloro-Quinazoline

4-Chloroquinazoline

CAS: 5190-68-1

Formula: C₈H₅ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.5917

Ref: IN-DA003L8G

4-Chloroquinazoline

CAS: 5190-68-1

4-Chloroquinazoline

Formula: C₈H₅ClN₂

Purity: 98%

Color and Shape: cream solid

Molecular weight: 164.59g/mol

Ref: 54-OR912468

4-Chloroquinazoline

CAS: 5190-68-1

Formula: C₈H₅ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.59

Ref: 10-F044662