CAS 519018-52-1

7-iodobenzofuran-3-one

Description:

7-Iodobenzofuran-3-one is an organic compound characterized by its unique structure, which includes a benzofuran ring system substituted with an iodine atom at the 7-position and a carbonyl group at the 3-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of the carbonyl group. The iodine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions and coupling reactions. Additionally, the presence of the benzofuran moiety may impart interesting biological activities, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents and may exhibit moderate to low solubility in water, depending on the specific conditions. Its molecular structure allows for potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with iodine and organic compounds.

Formula: C₈H₅IO₂

InChI: InChI=1/C8H5IO2/c9-6-3-1-2-5-7(10)4-11-8(5)6/h1-3H,4H2

SMILES: c1cc2C(=O)COc2c(c1)I

Synonyms:

• 3(2H)-benzofuranone, 7-iodo-
• 7-Iodo-1-benzofuran-3(2H)-one

7-Bromo-3(2H)-benzofuranone

CAS: 519018-52-1

Formula: C₈H₅BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.0281

Ref: IN-DA0037PY

7-Bromobenzo[b]furan-3(2H)-one

CAS: 519018-52-1

7-Bromobenzo[b]furan-3(2H)-one

Formula: C₈H₅BrO₂

Purity: 95%

Color and Shape: light yellow to yellow solid

Molecular weight: 213.03g/mol

Ref: 54-OR400051

7-Bromo-3-benzofuranone

CAS: 519018-52-1

Formula: C₈H₅BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.03

Ref: 10-F079077