CAS 51904-91-7: 5-(Chlorosulfonyl)-2-methoxybenzoic acid
Description:5-(Chlorosulfonyl)-2-methoxybenzoic acid is an organic compound characterized by its unique functional groups and structural features. It contains a benzoic acid moiety substituted with a chlorosulfonyl group and a methoxy group, which contribute to its reactivity and solubility properties. The presence of the chlorosulfonyl group makes it a strong electrophile, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its chemical properties, such as melting point, boiling point, and solubility, are influenced by the interactions between the functional groups and the overall molecular structure. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.
Formula:C8H7ClO5S
InChI:InChI=1S/C8H7ClO5S/c1-14-7-3-2-5(15(9,12)13)4-6(7)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=OUBZCDOQEMLMAB-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=CC=C1OC)S(=O)(=O)Cl
- Synonyms:
- 2-Methoxy-5-chlorosulfonylbenzoic acid
- 3-Carboxy-4-methoxybenzenesulfonyl chloride
- 5-(Chlorosulfonyl)-2-(methyloxy)benzoic acid
- 5-(Chlorosulfonyl)-o-anisic acid
- 5-Chlorosulfonyl-2-Methoxybenzoic Acid
- Benzoic acid, 5-(chlorosulfonyl)-2-methoxy-

5-(Chlorosulfonyl)-2-methoxybenzoic acid
Ref: IN-DA003MP2
1g | 113.00 € | ||
5g | 295.00 € | ||
10g | 501.00 € | ||
100mg | 60.00 € | ||
250mg | 63.00 € |

5-(Chlorosulphonyl)-2-methoxybenzoic acid
Ref: 54-OR2111
1g | 70.00 € | ||
5g | 228.00 € | ||
25g | 707.00 € |

Ref: 4Z-S-3524
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

5-Chlorosulfonyl-2-methoxybenzoic acid
Ref: 10-F017150
1g | 91.00 € | ||
2g | To inquire | ||
5g | 232.00 € | ||
10g | 412.00 € |

5-Chlorosulfonyl-2-methoxybenzoic acid
Ref: 3D-BCA90491
5g | 531.00 € |