CAS 51904-91-7
:5-(Chlorosulfonyl)-2-methoxybenzoic acid
Description:
5-(Chlorosulfonyl)-2-methoxybenzoic acid is an organic compound characterized by its unique functional groups and structural features. It contains a benzoic acid moiety substituted with a chlorosulfonyl group and a methoxy group, which contribute to its reactivity and solubility properties. The presence of the chlorosulfonyl group makes it a strong electrophile, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its chemical properties, such as melting point, boiling point, and solubility, are influenced by the interactions between the functional groups and the overall molecular structure. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.
Formula:C8H7ClO5S
InChI:InChI=1/C8H7ClO5S/c1-14-7-3-2-5(15(9,12)13)4-6(7)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=OUBZCDOQEMLMAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC(S(Cl)(=O)=O)=C1
Synonyms:- 2-Methoxy-5-chlorosulfonylbenzoic acid
- 3-Carboxy-4-methoxybenzenesulfonyl chloride
- 5-(Chlorosulfonyl)-2-(methyloxy)benzoic acid
- 5-(Chlorosulfonyl)-o-anisic acid
- 5-Chlorosulfonyl-2-Methoxybenzoic Acid
- Benzoic acid, 5-(chlorosulfonyl)-2-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(Chlorosulfonyl)-2-methoxybenzoic acid
CAS:Formula:C8H7ClO5SPurity:98%Color and Shape:SolidMolecular weight:250.65625-(Chlorosulphonyl)-2-methoxybenzoic acid
CAS:5-(Chlorosulphonyl)-2-methoxybenzoic acidFormula:C8H7ClO5SPurity:≥95%Color and Shape: white solidMolecular weight:250.66g/mol5-Chlorosulfonyl-2-methoxybenzoic acid
CAS:Formula:C8H7ClO5SPurity:98%Color and Shape:SolidMolecular weight:250.655-Chlorosulfonyl-2-methoxybenzoic acid
CAS:5-Chlorosulfonyl-2-methoxybenzoic acid is a reactive chemical that belongs to the group of carboxylic acids. This chemical has been used in the optimization of benzoate production by reacting with an azide and chlorinating. It can also be used as a pest control agent, as it reacts with chloride ions to form toxic sulfonyl chlorides. 5-Chlorosulfonyl-2-methoxybenzoic acid has been shown to be effective as a control agent for salicylic and salicylic acid, which are plant growth hormones that inhibit cell division in plants.Formula:C8H7ClO5SPurity:Min. 95%Molecular weight:250.66 g/mol




