CAS 519056-61-2

[4-(tert-butyl)phenyl]methanesulfonyl chloride

Description:

[4-(tert-butyl)phenyl]methanesulfonyl chloride, with the CAS number 519056-61-2, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a phenyl ring that is further substituted with a tert-butyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly in nucleophilic substitution reactions, where the sulfonyl chloride group can act as a leaving group. The tert-butyl group provides steric hindrance, influencing the compound's reactivity and solubility in various organic solvents. Additionally, [4-(tert-butyl)phenyl]methanesulfonyl chloride is utilized in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. Due to the presence of the sulfonyl chloride moiety, it can be corrosive and should be handled with care, following appropriate safety protocols to avoid skin and respiratory irritation.

Formula: C₁₁H₁₅ClO₂S

InChI: InChI=1/C11H15ClO2S/c1-11(2,3)10-6-4-9(5-7-10)8-15(12,13)14/h4-7H,8H2,1-3H3

SMILES: CC(C)(C)c1ccc(cc1)CS(=O)(=O)Cl

4-tert-Butylbenzylsulphonyl chloride

CAS: 519056-61-2

4-tert-Butylbenzylsulphonyl chloride

Purity: 95%

Color and Shape: Viscous Liquid

Molecular weight: 246.75g/mol

Ref: 54-OR300728

(4-tert-butylphenyl)methanesulfonyl chloride

CAS: 519056-61-2

Purity: 97%

Molecular weight: 246.75

Ref: 10-F635998

(4-tert-Butylphenyl)methanesulfonyl chloride

CAS: 519056-61-2

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClO₂S

Purity: Min. 95%

Molecular weight: 246.76 g/mol

Ref: 3D-UVA05661