CAS 519146-70-4

N-(2-chloropyridin-3-yl)cyclopropanecarboxamide

Description:

N-(2-chloropyridin-3-yl)cyclopropanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a chlorinated pyridine moiety. The presence of the 2-chloropyridine group contributes to its potential biological activity, as halogenated pyridines are often found in pharmaceuticals and agrochemicals due to their ability to interact with various biological targets. The cyclopropanecarboxamide functional group suggests that this compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. Additionally, the compound's molecular structure may impart specific steric and electronic characteristics, affecting its interaction with enzymes or receptors. Its CAS number, 519146-70-4, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound's unique features make it a subject of interest for further investigation in various chemical and biological applications.

Formula: C₉H₉ClN₂O

InChI: InChI=1/C9H9ClN2O/c10-8-7(2-1-5-11-8)12-9(13)6-3-4-6/h1-2,5-6H,3-4H2,(H,12,13)

SMILES: c1cc(c(Cl)nc1)N=C(C1CC1)O

Synonyms:

• cyclopropanecarboxamide, N-(2-chloro-3-pyridinyl)-

N-(2-chloro-3-pyridinyl)cyclopropanecarboxamide

CAS: 519146-70-4

Formula: C₉H₉ClN₂O

Purity: 95.0%

Molecular weight: 196.63

Ref: 10-F315408