CAS 5192-62-1
:3,6-Dimethyl-4-hydroxy-2-pyrone
Description:
3,6-Dimethyl-4-hydroxy-2-pyrone, with the CAS number 5192-62-1, is an organic compound belonging to the class of pyrones, which are characterized by a six-membered aromatic ring containing a carbonyl group and an ether oxygen. This compound features two methyl groups at the 3 and 6 positions and a hydroxyl group at the 4 position, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, exhibiting solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the hydroxyl group enhances its reactivity, allowing it to participate in various chemical reactions, including esterification and oxidation. Additionally, 3,6-Dimethyl-4-hydroxy-2-pyrone has been studied for its potential applications in pharmaceuticals, food chemistry, and as a natural dye due to its color properties. Its structural features also suggest possible antioxidant and antimicrobial activities, making it a compound of interest in various fields of research.
Formula:C7H8O3
InChI:InChI=1/C7H8O3/c1-4-3-6(8)5(2)7(9)10-4/h3,8H,1-2H3
SMILES:Cc1cc(c(C)c(=O)o1)O
Synonyms:- 4-Hydroxy-3,6-dimethyl-2H-pyran-2-one
- Hdmpo
- 2H-Pyran-2-one, 4-hydroxy-3,6-dimethyl-
- 2-hydroxy-3,6-dimethyl-4H-pyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Hydroxy-3,6-dimethyl-2-pyrone, 97%
CAS:4-Hydroxy-3,6-dimethyl-2-pyrone is the reactant in the formation of unnatural novel polyketides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prFormula:C7H8O3Purity:97%Color and Shape:White, PowderMolecular weight:140.144-Hydroxy-3,6-dimethyl-2H-pyran-2-one
CAS:Formula:C7H8O3Color and Shape:SolidMolecular weight:140.1366

