CAS 51920-94-6
:(4S)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione
Description:
The chemical substance known as (4S)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione, with the CAS number 51920-94-6, is a bicyclic compound characterized by its unique structural features, including a bicyclo[2.2.2]octane framework and multiple functional groups. The presence of sulfur atoms in the form of dithia indicates that it contains thioether linkages, which can influence its reactivity and stability. The hydroxymethyl group suggests potential for hydrogen bonding and solubility in polar solvents, while the benzyl group may enhance lipophilicity and contribute to the compound's overall biological activity. The dimethyl substitutions indicate steric hindrance, which can affect the compound's conformation and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C14H16N2O3S2
InChI:InChI=1/C14H16N2O3S2/c1-15-12(19)14(9-17)16(2)11(18)13(15,20-21-14)8-10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3/t13?,14-/m0/s1
SMILES:CN1C(=O)[C@@]2(CO)N(C)C(=O)C1(Cc1ccccc1)SS2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Hyalodendrin I; A 26771A; 3-Benzyl-6-hydroxymethyl-1,4-dimethyl- 3,6-epidithiopiperazin
CAS:Formula:C14H16N2O3S2Purity:94.49%Color and Shape:Brownish. Amorphous solidMolecular weight:324.0(+)-Hyalodendrin
CAS:Controlled ProductFormula:C14H16N2O3S2Color and Shape:NeatMolecular weight:324.42(+)-Hyalodendrin-d5
CAS:Controlled ProductFormula:C14D5H11N2O3S2Color and Shape:NeatMolecular weight:329.449Hyalodendrin
CAS:Hyalodendrin is a novel bioactive compound extracted from the natural metabolites of specific fungal species. It operates primarily through the selective modulation of cellular receptors, which influences signal transduction pathways. This precise targeting results in altered gene expression patterns, facilitating various biological responses relevant to medical science.Formula:C14H16N2O3S2Purity:Min. 95%Molecular weight:324.40 g/molHyalodendrin
CAS:Hyalodendrin ((+)-Hyalodendrin) acts as a fungal growth inhibitor, specifically targeting wood decay fungi. It exhibits low phytotoxicity and possesses an acute toxicity (LD50) level of 75 mg/kg in mice.Formula:C14H16N2O3S2Color and Shape:SolidMolecular weight:324.42



