CAS 51934-39-5

7-bromonaphthalene-1-carboxylic acid

Description:

7-Bromonaphthalene-1-carboxylic acid is an aromatic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant stability and hydrophobic characteristics. The bromine substituent at the 7-position introduces both electronegativity and steric effects, influencing its reactivity and interactions with other molecules. The carboxylic acid group (-COOH) imparts acidic properties, allowing the compound to participate in various chemical reactions, such as esterification and amidation. Additionally, the presence of the carboxylic acid enhances its solubility in polar solvents compared to non-polar naphthalene derivatives. 7-Bromonaphthalene-1-carboxylic acid is often utilized in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to its functional versatility. Its unique structural features make it a valuable intermediate in the development of more complex chemical entities.

Formula: C₁₁H₇BrO₂

InChI: InChI=1/C11H7BrO2/c12-8-5-4-7-2-1-3-9(11(13)14)10(7)6-8/h1-6H,(H,13,14)

7-bromo-1-naphthoic acid

CAS: 51934-39-5

Formula: C₁₁H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.0761

Ref: IN-DA0038OB

7-Bromo-1-naphthoic acid

CAS: 51934-39-5

7-Bromo-1-naphthoic acid

Purity: 95%

Molecular weight: 251.079g/mol

Ref: 54-OR73818

7-Bromo-1-naphthoic acid

CAS: 51934-39-5

Formula: C₁₁H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.079

Ref: 10-F334460

7-Bromo-1-naphthoic acid

CAS: 51934-39-5

Versatile small molecule scaffold

Formula: C₁₁H₇BrO₂

Purity: Min. 95%

Molecular weight: 251.08 g/mol

Ref: 3D-BCA93439