CAS 51936-55-1
:7,8-Dibromo-1,2,3,4,11,11-hexachloro-1,4,4a,5,6,7,8,9,10,10a-decahydro-1,4-methanobenzocyclooctene
Description:
7,8-Dibromo-1,2,3,4,11,11-hexachloro-1,4,4a,5,6,7,8,9,10,10a-decahydro-1,4-methanobenzocyclooctene, with CAS number 51936-55-1, is a complex organic compound characterized by its extensive halogenation, specifically containing both bromine and chlorine atoms. This compound features a bicyclic structure, which contributes to its unique chemical properties. The presence of multiple halogen substituents typically enhances the compound's stability and lipophilicity, making it of interest in various chemical applications, including potential use in agrochemicals or as a flame retardant. Its molecular structure suggests that it may exhibit significant biological activity, although specific toxicity and environmental impact data would be necessary for a comprehensive assessment. Additionally, the intricate arrangement of its hydrogenated carbon framework indicates potential for diverse reactivity patterns in synthetic chemistry. As with many halogenated compounds, careful handling and consideration of regulatory guidelines are essential due to potential environmental and health implications.
Formula:C13H12Br2Cl6
InChI:InChI=1S/C13H12Br2Cl6/c14-7-3-1-5-6(2-4-8(7)15)12(19)10(17)9(16)11(5,18)13(12,20)21/h5-8H,1-4H2
InChI key:InChIKey=XRFONNJUMOCNHA-UHFFFAOYSA-N
SMILES:ClC12C3C(C(Cl)(C1(Cl)Cl)C(Cl)=C2Cl)CCC(Br)C(Br)CC3
Synonyms:- 1,4-Methanobenzocyclooctene, 7,8-dibromo-1,2,3,4,11,11-hexachloro-1,4,4a,5,6,7,8,9,10,10a-decahydro-
- 5,6-Dibromo-1,10,11,12,13,13-hexachloro-11-tricyclo[8.2.1.0<sup>2,9</sup>]tridecene
- 7,8-Dibromo-1,2,3,4,11,11-Hexachloro-1,4,4A,5,6,7,8,9,10,10A-Decahydro-1,4-Methanobenzo[8]Annulene
- Citex BC 26
- Hcdbco
- Saytex BC 26
- 7,8-Dibromo-1,2,3,4,11,11-hexachloro-1,4,4a,5,6,7,8,9,10,10a-decahydro-1,4-methanobenzocyclooctene
- 5,6-Dibromo-1,10,11,12,13,13-hexachloro-11-tricyclo[8.2.1.02,9]tridecene
- 7,8-Dibromo-1,2,3,4,11,11-hexachloro-1,4,4a,5,6,7,8,9,10,10a-decahydro-1,4-methanobenzocyclooctene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Dibromo-1,10,11,12,13,13-hexachloro-11-tricyclo[8.2.1.02,9]tridecene
CAS:<p>Stability Light Sensitive<br>Applications 5,6-Dibromo-1,10,11,12,13,13-hexachloro-11-tricyclo[8.2.1.02,9]tridecene is a flame retardant and a standard for environmental testing and research.<br>References EPA. Method 1668, (EPA 821-R-00-002) (1999); Dodson, R. E., et al.: Environ. Sci. Technol. 51, 4860 (2017)<br></p>Formula:C13H12Br2Cl6Color and Shape:NeatMolecular weight:540.76
