CymitQuimica logo

CAS 51937-85-0

:

1,3,5-Benzenetricarboxylic acid, copper salt (1:?)

Description:
1,3,5-Benzenetricarboxylic acid, copper salt (1:?) is a coordination compound formed from the reaction of copper ions with 1,3,5-benzenetricarboxylic acid. This compound typically exhibits characteristics associated with metal-organic frameworks, including potential applications in catalysis, materials science, and as a precursor for various chemical syntheses. The copper salt form often displays enhanced thermal stability and solubility in polar solvents, which can facilitate its use in various chemical processes. The presence of carboxylate groups allows for strong interactions with metal ions, contributing to the compound's structural integrity and functionality. Additionally, the compound may exhibit interesting optical properties due to the presence of copper, which can influence its color and reactivity. Its coordination chemistry can lead to diverse structural arrangements, making it a subject of interest in both academic and industrial research. Safety data should be consulted for handling, as metal salts can pose health risks if not managed properly.
Formula:C9H6O6·xCu
InChI:InChI=1S/C9H6O6.Cu/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;/h1-3H,(H,10,11)(H,12,13)(H,14,15);
InChI key:InChIKey=DHOBEDGRIOTEBA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1.[Cu]
Synonyms:
  • 1,3,5-Benzenetricarboxylic acid, copper salt (1:?)
  • Copper benzene-1,3,5-tricarboxylate
  • 1,3,5-Benzenetricarboxylic acid, copper salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.