CAS 51938-10-4

10H-Phenothiazin-2-ol, 8-chloro-10-[3-(dimethylamino)propyl]-,monohydrochloride

Description:

10H-Phenothiazin-2-ol, 8-chloro-10-[3-(dimethylamino)propyl]-, monohydrochloride, commonly known as a phenothiazine derivative, exhibits several notable characteristics. This compound features a phenothiazine core, which is a tricyclic structure containing sulfur and nitrogen atoms, contributing to its pharmacological properties. The presence of a chloro substituent and a dimethylamino propyl side chain enhances its biological activity, often leading to applications in medicinal chemistry, particularly as an antipsychotic or sedative agent. The hydrochloride form indicates that it is a salt, which typically improves solubility in water, making it more bioavailable. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, influencing its distribution in biological systems. Additionally, it may interact with various neurotransmitter receptors, which is a common mechanism of action for many phenothiazine derivatives. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and side effects associated with its pharmacological use.

Formula: C₁₇H₁₉ClN₂OSClH

InChI: InChI=1S/C17H19ClN2OS.ClH/c1-19(2)8-3-9-20-14-10-12(18)4-6-16(14)22-17-7-5-13(21)11-15(17)20;/h4-7,10-11,21H,3,8-9H2,1-2H3;1H

InChI key: InChIKey=FJEAGKRVYJSHKN-UHFFFAOYSA-N

SMILES: C(CCN(C)C)N1C=2C(SC=3C1=CC(O)=CC3)=CC=C(Cl)C2.Cl

8-Hydroxychlorpromazine-d6 Hydrochloride

Controlled Product

CAS: 3926-67-8, 51938-10-4

Formula: C₁₇D₆H₁₃ClN₂OS·HCl

Color and Shape: Neat

Molecular weight: 377.361

Ref: TR-H824907

8-Hydroxychlorpromazine Hydrochloride

Controlled Product

CAS: 51938-10-4

Formula: C₁₇H₁₉ClN₂OS·HCl

Color and Shape: Neat

Molecular weight: 371.32

Ref: TR-H824905