CAS 51938-17-1
:4-[nitroso(trideuteriomethyl)amino]butanoic acid
Description:
4-[Nitroso(trideuteriomethyl)amino]butanoic acid, with the CAS number 51938-17-1, is a chemical compound characterized by the presence of a nitroso group (-NO) attached to a trideuteriomethylamino group, which is further linked to a butanoic acid moiety. This compound features a butanoic acid backbone, indicating it has a four-carbon chain with a carboxylic acid functional group (-COOH) at one end. The incorporation of the nitroso group suggests potential reactivity, particularly in biological systems, where nitroso compounds can participate in various chemical reactions, including those involving nitric oxide signaling. The presence of deuterium in the trideuteriomethyl group indicates that the hydrogen atoms in the methyl group have been replaced with deuterium isotopes, which can influence the compound's physical properties, such as its mass and stability. Overall, this compound may be of interest in research fields such as medicinal chemistry and biochemistry, particularly in studies involving nitrogen oxides and their biological implications.
Formula:C5H7D3N2O3
InChI:InChI=1/C5H10N2O3/c1-7(6-10)4-2-3-5(8)9/h2-4H2,1H3,(H,8,9)/i1D3
SMILES:C(N(CCCC(=O)O)N=O)([2H])([2H])[2H]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-Nitroso-N-methyl-4-aminobutyric Acid Methyl Ester
CAS:Controlled ProductApplications The methyl ester of the nitrosamino acid, N-Nitroso-N-methylaminobutyric acid. This N-nitrosamino acid has been isolated and identified in various types of tobacco, including snuff, chewing and pipe tobacco, cigars and cigarettes.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Suzuki, E., et al.: Chem. Pharm. Bull., 28, 1612 (1980), Ohshima, H, et al.: Cancer Letters, 26, 153 (1985).Formula:C6H12N2O3Color and Shape:YellowMolecular weight:160.17N-Nitroso-N-methyl-4-aminobutyric acid methyl ester
CAS:Please enquire for more information about N-Nitroso-N-methyl-4-aminobutyric acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C6H12N2O3Purity:Min. 95%Molecular weight:160.17 g/mol

