CAS 51938-19-3
:2-[methyl(nitroso)amino]propanoic acid
Description:
2-[Methyl(nitroso)amino]propanoic acid, with the CAS number 51938-19-3, is an organic compound characterized by the presence of a propanoic acid backbone substituted with a methyl(nitroso)amino group. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidic properties, while the nitroso group (-NO) attached to the amino group introduces unique reactivity and potential biological activity. The presence of the methyl group enhances its steric properties, influencing its interactions in chemical reactions. As a nitroso compound, it may exhibit properties related to nitrosation, which can be significant in biological systems and environmental chemistry. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and redox processes. Additionally, due to its potential biological implications, it may be of interest in pharmacological studies or toxicological assessments. Overall, 2-[methyl(nitroso)amino]propanoic acid represents a complex molecule with diverse chemical characteristics and potential applications in research.
Formula:C4H8N2O3
InChI:InChI=1/C4H8N2O3/c1-3(4(7)8)6(2)5-9/h3H,1-2H3,(H,7,8)
SMILES:CC(C(=O)O)N(C)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Nitroso Sarcosine Methyl Ester
CAS:Controlled ProductFormula:C4H8N2O3Color and Shape:NeatMolecular weight:132.118
