CAS 51939-71-0
:chromane-2-carboxylic acid
Description:
Chromane-2-carboxylic acid, identified by its CAS number 51939-71-0, is a chemical compound that belongs to the class of chromanes, which are bicyclic compounds featuring a benzene ring fused to a tetrahydrofuran ring. This compound is characterized by the presence of a carboxylic acid functional group (-COOH) at the 2-position of the chromane structure, which contributes to its acidic properties. Chromane-2-carboxylic acid is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the hydrophilic nature of the carboxylic acid group. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound can participate in various chemical reactions, including esterification and amidation, due to its reactive carboxylic acid group. Its structural features may also allow for potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6H2,(H,11,12)
SMILES:c1ccc2c(c1)CCC(C(=O)O)O2
Synonyms:- 3,4-dihydro-2H-chromene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dihydro-2H-1-benzopyran-2-carboxylic acid
CAS:Formula:C10H10O3Purity:98%Color and Shape:SolidMolecular weight:178.1846Chroman-2-carboxylic acid
CAS:Chroman-2-carboxylic acidPurity:97%Color and Shape:SolidMolecular weight:178.18g/molChromane-2-carboxylic acid
CAS:Formula:C10H10O3Purity:98%Color and Shape:SolidMolecular weight:178.187Chromane-2-carboxylic Acid
CAS:Controlled ProductApplications Chromane-2-carboxylic Acid is used in the synthesis of 4-quinazolinones as Rho kinase inhibitors for application towards glaucoma, hypertension and spinal cord injuries. It is also used in the preparation of chromanyl-benzamidazoles as anti-bacterial compounds.
References Fang, X. et al.: Bioorg. Med. Chem. Lett., 21, 1844 (2011); Raut, C. et al.: J. Hetero. Chem., 47, 582 (2010);Formula:C10H10O3Color and Shape:NeatMolecular weight:178.18Chromane-2-carboxylic Acid
CAS:Chromane-2-carboxylic acid is an amide with a hydroxy group that has inhibitory effects on alkoxyphenols. It has been shown to have the ability to inhibit the growth of cancer cells in mammalian tissue and has been used in synthesizing nitro compounds. Chromane-2-carboxylic acid also inhibits matrix metalloproteinases, which are enzymes that break down proteins in the extracellular matrix and are associated with tumor invasion and metastasis. This compound also has radical scavenging activities, which may be due to its ability to form hydrogen bonds or intramolecular hydrogen bonds with aromatic hydrocarbons or fatty acids.Formula:C10H10O3Purity:Min. 95%Molecular weight:178.18 g/mol




