CAS 5194-32-1
:2-Methylpyrimidine-5-carboxylic acid
Description:
2-Methylpyrimidine-5-carboxylic acid, with the CAS number 5194-32-1, is an organic compound that belongs to the class of pyrimidine derivatives. This compound features a pyrimidine ring substituted with a methyl group at the second position and a carboxylic acid group at the fifth position. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and organic solvents, which is characteristic of many carboxylic acids. The presence of both the methyl and carboxylic acid functional groups contributes to its chemical reactivity, allowing it to participate in various organic reactions, such as esterification and amidation. Additionally, 2-methylpyrimidine-5-carboxylic acid can serve as an important intermediate in the synthesis of pharmaceuticals and agrochemicals. Its molecular structure allows for potential hydrogen bonding, influencing its physical properties and interactions in biological systems. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-4-7-2-5(3-8-4)6(9)10/h2-3H,1H3,(H,9,10)
SMILES:Cc1ncc(cn1)C(=O)O
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methylpyrimidine-5-carboxylic acid, 97%
CAS:<p>It is employed in the synthesis, spectral characterization and anticancer activity of new 2,3,6- substituted quinazolin-4(3h)-one derivatives. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to</p>Formula:C6H6N2O2Purity:97%Molecular weight:138.132-Methylpyrimidine-5-carboxylic acid
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.1240Ref: IN-DA003HQE
1g25.00€5g52.00€10g66.00€1kgTo inquire25g127.00€100g357.00€500gTo inquire100mgTo inquire250mg21.00€2-Methylpyrimidine-5-carboxylic acid
CAS:2-Methylpyrimidine-5-carboxylic acidFormula:C6H6N2O2Purity:98%Color and Shape: lemon crystalline powderMolecular weight:138.12g/mol2-Methylpyrimidine-5-carboxylic acid
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.126




