CAS 51964-22-8
:3-(4-fluorophenyl)-1,3-thiazolidine-2,4-dione
Description:
3-(4-Fluorophenyl)-1,3-thiazolidine-2,4-dione, with the CAS number 51964-22-8, is a heterocyclic compound characterized by a thiazolidine ring containing both a fluorophenyl group and two carbonyl (keto) functionalities. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the fluorine atom on the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and biological activity. Thiazolidinediones, the class to which this compound belongs, are known for their role in medicinal chemistry, particularly in the development of antidiabetic agents. The thiazolidine structure contributes to its ability to interact with biological targets, making it of interest in pharmacological research. Additionally, the compound's stability and reactivity can be influenced by the substituents on the thiazolidine ring, which may affect its potential applications in various chemical and biological contexts.
Formula:C9H6FNO2S
InChI:InChI=1/C9H6FNO2S/c10-6-1-3-7(4-2-6)11-8(12)5-14-9(11)13/h1-4H,5H2
SMILES:c1cc(ccc1F)N1C(=O)CSC1=O
Synonyms:- 2,4-Thiazolidinedione, 3-(4-fluorophenyl)-
- 3-(4-Fluoro-phenyl)-thiazolidine-2,4-dione
- 3-(4-Fluorophenyl)-1,3-thiazolidine-2,4-dione
- 3-(4-FLUOROPHENYL)-2,4-THIAZOLIDINEDIONE
- AKOS B029018
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.